ChemNet > CAS > 39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
39827-11-7 Benzo[b]thiophene-2-carbonyl chloride
نام محصول |
Benzo[b]thiophene-2-carbonyl chloride |
نام انگلیسی |
Benzo[b]thiophene-2-carbonyl chloride; Thianaphthene-2-carbonyl chloride; 1-benzothiophene-2-carbonyl chloride |
میدان مغناطیسی |
C9H5ClOS |
وزن مولکولی |
196.6534 |
InChI |
InChI=1/C9H5ClOS/c10-9(11)8-5-6-3-1-2-4-7(6)12-8/h1-5H |
شماره سیایاس |
39827-11-7 |
ساختار مولکولی |
|
تراکم |
1.41g/cm3 |
نقطه ذوب |
85℃ |
نقطه غلیان |
309.5°C at 760 mmHg |
ضریب شکست |
1.68 |
نقطه اشتعال |
141°C |
فشار بخار |
0.000636mmHg at 25°C |
خطر نمادها |
C:Corrosive;
|
کدهای خطر |
R34:Causes burns.;
|
توضیحات ایمنی |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|